![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | _vti_cnf/ | 2013-03-18 15:52 | - | |
![[ ]](/icons/unknown.gif) | WaferMapper Rev 1.xlsb | 2013-03-10 21:14 | 147K | |
![[ ]](/icons/unknown.gif) | Single Plotter (Fine Bins) Rev 5.xlsb | 2013-03-10 21:14 | 31M | |
![[ ]](/icons/unknown.gif) | Rel Calculator Rev 3.xlsb | 2013-02-19 14:38 | 49K | |
![[ ]](/icons/unknown.gif) | Multi Plotter Rev 4.xlsb | 2013-03-04 14:40 | 93K | |
![[ ]](/icons/unknown.gif) | Final Exam Workbook QRE Rev 3.xlsb | 2013-03-18 15:49 | 70K | |
![[ ]](/icons/unknown.gif) | Final Exam Workbook QRE Rev 3 (Solution).xlsb | 2013-03-18 15:49 | 88K | |
![[ ]](/icons/unknown.gif) | ECE 510 Problem 15.1 Solution Copy of Rel Calculator Rev 3.xlsb | 2013-03-14 16:16 | 145K | |
![[ ]](/icons/unknown.gif) | ECE 510 Midterm - Solutions.xlsx | 2013-02-13 16:23 | 199K | |
![[ ]](/icons/unknown.gif) | ECE 510 Midterm - Problems.xlsx | 2013-02-13 16:23 | 53K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 11 Homework 11_1 and 11_2 Solution (Rel Calculator Rev 3).xlsb | 2013-02-27 00:18 | 202K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 11 Homework 11_1 and 11_2 Problem (Rel Calculator Rev 3).xlsb | 2013-02-27 00:18 | 251K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 10 Problem (Rel Calculator Rev 3).xlsb | 2013-02-26 16:30 | 193K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 9, Si Mechanisms, MLE - Solutions.xlsx | 2013-02-06 15:07 | 112K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 9, Si Mechanisms, MLE - Problems.xlsx | 2013-02-06 15:07 | 78K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 8, Acceleration, MLE - Solutions.xlsx | 2013-02-04 17:12 | 121K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 8, Acceleration, MLE - Problems.xlsx | 2013-02-04 17:12 | 55K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 8, Acceleration, MLE, Rev 2 - Solutions.xlsx | 2013-02-06 15:07 | 29K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 7, Goodness of fit, MLE - Problems.xlsx | 2013-01-30 17:12 | 128K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 7, Goodness of fit, MLE, Rev 2 - Solutions.xlsx | 2013-02-06 15:07 | 107K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 6, Confidence Limits - Solutions.xlsx | 2013-02-04 21:46 | 132K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 6, Confidence Limits - Problems.xlsx | 2013-01-28 17:23 | 15K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 6, Confidence Limits, Rev 2 - Solutions.xlsx | 2013-02-06 15:07 | 133K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 5, Plotting 3 - Solutions.xlsx | 2013-02-04 21:46 | 176K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 5, Plotting 3 - Problems.xlsx | 2013-01-23 16:28 | 144K | |
![[ ]](/icons/layout.gif) | ECE 510 Lecture 5, Plotting 3, Randoms.pdf | 2013-01-23 16:30 | 881K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 4, Plotting 2 - Solutions.xlsx | 2013-01-23 16:28 | 191K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 4, Plotting 2 - Problems.xlsx | 2013-01-16 15:02 | 63K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Solutions Rev 2.xlsx | 2013-01-23 16:30 | 71K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Solutions.xlsx | 2013-01-14 16:09 | 144K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Problems Rev 2.xlsx | 2013-01-16 15:02 | 14K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Problems.xlsx | 2013-01-14 16:08 | 33K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting.xlsx | 2013-01-06 16:59 | 103K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting - Solutions.xlsx | 2013-01-16 21:26 | 55K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting - Problems Rev 2.xlsx | 2013-01-16 15:02 | 38K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting - Problems.xlsx | 2013-01-09 16:05 | 45K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 1, Monte Carlo.xlsx | 2013-01-06 16:59 | 13K | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 1, Monte Carlo - Solution.xlsx | 2013-01-16 15:02 | 267K | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 Synthesis of SRAM Data In-Class Example 4.xlsb | 2013-03-04 14:42 | 62K | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 Kaplan Meier Multicensored Homework Solution.xlsb | 2013-02-28 00:19 | 533K | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 Kaplan Meier Multicensored Homework Problem.xlsb | 2013-02-28 00:19 | 700K | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 KMG Fit of SRAM Data In-Class Example 3.xlsb | 2013-03-04 14:42 | 544K | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 13 Homework 1 Solution.xlsb | 2013-02-26 23:15 | 234K | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 13 Homework 1 Problem.xlsb | 2013-02-26 23:15 | 228K | |
|