![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 1, Monte Carlo.xlsx | 2013-01-06 22:26 | 318 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting.xlsx | 2013-01-06 22:26 | 319 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting - Problems.xlsx | 2013-01-09 16:07 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Solutions.xlsx | 2013-01-14 16:09 | 319 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Problems.xlsx | 2013-01-14 16:10 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 1, Monte Carlo - Solution.xlsx | 2013-01-16 15:12 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting - Problems Rev 2.xlsx | 2013-01-16 15:12 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Problems Rev 2.xlsx | 2013-01-16 15:12 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 4, Plotting 2 - Problems.xlsx | 2013-01-16 15:12 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 2, Plotting - Solutions.xlsx | 2013-01-16 21:27 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 3, Functions - Solutions Rev 2.xlsx | 2013-01-23 16:31 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 5, Plotting 3 - Problems.xlsx | 2013-01-23 16:31 | 422 | |
![[ ]](/icons/layout.gif) | ECE 510 Lecture 5, Plotting 3, Randoms.pdf | 2013-01-27 21:38 | 377 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 6, Confidence Limits - Problems.xlsx | 2013-01-28 17:25 | 375 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 7, Goodness of fit, MLE - Problems.xlsx | 2013-01-30 17:15 | 376 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 8, Acceleration, MLE - Problems.xlsx | 2013-02-04 17:13 | 375 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 4, Plotting 2 - Solutions.xlsx | 2013-02-04 21:48 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 5, Plotting 3 - Solutions.xlsx | 2013-02-04 21:48 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 6, Confidence Limits - Solutions.xlsx | 2013-02-04 21:48 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 8, Acceleration, MLE, Rev 2 - Solutions.xlsx | 2013-02-06 15:07 | 318 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 6, Confidence Limits, Rev 2 - Solutions.xlsx | 2013-02-06 15:16 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 7, Goodness of fit, MLE, Rev 2 - Solutions.xlsx | 2013-02-06 15:16 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 9, Si Mechanisms, MLE - Problems.xlsx | 2013-02-06 15:16 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 9, Si Mechanisms, MLE - Solutions.xlsx | 2013-02-11 12:35 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 8, Acceleration, MLE - Solutions.xlsx | 2013-02-12 17:59 | 376 | |
![[ ]](/icons/unknown.gif) | ECE 510 Midterm - Problems.xlsx | 2013-02-13 17:07 | 427 | |
![[ ]](/icons/unknown.gif) | ECE 510 Midterm - Solutions.xlsx | 2013-02-18 21:07 | 428 | |
![[ ]](/icons/unknown.gif) | Rel Calculator Rev 3.xlsb | 2013-02-19 14:40 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 10 Problem (Rel Calculator Rev 3).xlsb | 2013-02-26 16:31 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 11 Homework 11_1 and 11_2 Problem (Rel Calculator Rev 3).xlsb | 2013-02-27 16:14 | 319 | |
![[ ]](/icons/unknown.gif) | ECE 510 Lecture 11 Homework 11_1 and 11_2 Solution (Rel Calculator Rev 3).xlsb | 2013-02-27 16:14 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 KMG Fit of SRAM Data In-Class Example 3.xlsb | 2013-03-04 14:43 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 Synthesis of SRAM Data In-Class Example 4.xlsb | 2013-03-04 14:43 | 363 | |
![[ ]](/icons/unknown.gif) | Multi Plotter Rev 4.xlsb | 2013-03-04 14:43 | 363 | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 13 Homework 1 Problem.xlsb | 2013-03-06 15:21 | 319 | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 13 Homework 1 Solution.xlsb | 2013-03-06 15:21 | 364 | |
![[ ]](/icons/unknown.gif) | Single Plotter (Fine Bins) Rev 5.xlsb | 2013-03-10 21:14 | 366 | |
![[ ]](/icons/unknown.gif) | WaferMapper Rev 1.xlsb | 2013-03-10 21:14 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 Kaplan Meier Multicensored Homework Problem.xlsb | 2013-03-13 14:04 | 319 | |
![[ ]](/icons/unknown.gif) | ECE 510, Lecture 14 Kaplan Meier Multicensored Homework Solution.xlsb | 2013-03-13 14:04 | 364 | |
![[ ]](/icons/unknown.gif) | ECE 510 Problem 15.1 Solution Copy of Rel Calculator Rev 3.xlsb | 2013-03-14 16:16 | 364 | |
![[ ]](/icons/unknown.gif) | Final Exam Workbook QRE Rev 3 (Solution).xlsb | 2013-03-18 15:49 | 318 | |
![[ ]](/icons/unknown.gif) | Final Exam Workbook QRE Rev 3.xlsb | 2013-03-18 16:22 | 363 | |
|