![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| KAMELA Continued dimensional scaling of CMOS processes is approaching fundamental limits and therefore.docx | 2016-04-18 16:23 | 13K | |
| MEMRISTors - WWoodsMSThesisFinalDraft.pdf | 2016-02-05 10:55 | 1.2M | |
| Muayad PaperMCT-V1 (1).docx | 2016-04-16 14:20 | 585K | |
| Nano-Crossbar Memories Comprising Parallel.pptx | 2016-03-15 11:33 | 4.7M | |
| Nano-Crossbar Memories Comprising Parallel [Autosaved].pptx | 2016-03-25 09:45 | 4.6M | |
| Synthesis of Memristive Circuits old.docx | 2016-04-11 12:14 | 323K | |
| gam for KAMELA.pdf | 2014-01-03 11:58 | 1.2M | |